C13H19ClN2O — CID 114581901
6-chloro-3-(3,4-dimethylcyclohexyl)-2-methylpyrimidin-4-one (PubChem CID 114581901) has the molecular formula C13H19ClN2O and a molecular weight of 254.76 g/mol. Its IUPAC name is 6-chloro-3-(3,4-dimethylcyclohexyl)-2-methylpyrimidin-4-one.
| Compound Name | 6-chloro-3-(3,4-dimethylcyclohexyl)-2-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 114581901 |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 6-chloro-3-(3,4-dimethylcyclohexyl)-2-methylpyrimidin-4-one |
| SMILES | Cc1nc(Cl)cc(=O)n1C1CCC(C)C(C)C1 |
| InChI | InChI=1S/C13H19ClN2O/c1-8-4-5-11(6-9(8)2)16-10(3)15-12(14)7-13(16)17/h7-9,11H,4-6H2,1-3H3 |
| InChIKey | BOFQONOIMYINBZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |