About 3-methyl-1,3-benzothiazine-2,4-dione
3-methyl-1,3-benzothiazine-2,4-dione (PubChem CID 11458209) has the molecular formula C9H7NO2S
and a molecular weight of 193.23 g/mol. Its IUPAC name is 3-methyl-1,3-benzothiazine-2,4-dione.
Molecular Properties
| Compound Name | 3-methyl-1,3-benzothiazine-2,4-dione |
| PubChem CID | 11458209 |
| Molecular Formula | C9H7NO2S |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.02 |
| IUPAC Name | 3-methyl-1,3-benzothiazine-2,4-dione |
| SMILES | Cn1c(=O)sc2ccccc2c1=O |
| InChI | InChI=1S/C9H7NO2S/c1-10-8(11)6-4-2-3-5-7(6)13-9(10)12/h2-5H,1H3 |
| InChIKey | SXKWTESFUNKJMK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-1,3-benzothiazine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,3-benzothiazine-2,4-dione?
The IUPAC name of 3-methyl-1,3-benzothiazine-2,4-dione (CID 11458209) is 3-methyl-1,3-benzothiazine-2,4-dione.
What is the SMILES notation for 3-methyl-1,3-benzothiazine-2,4-dione?
The canonical SMILES for 3-methyl-1,3-benzothiazine-2,4-dione is Cn1c(=O)sc2ccccc2c1=O.
What is the InChIKey of 3-methyl-1,3-benzothiazine-2,4-dione?
The InChIKey is SXKWTESFUNKJMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2S/c1-10-8(11)6-4-2-3-5-7(6)13-9(10)12/h2-5H,1H3.
What are the key properties of 3-methyl-1,3-benzothiazine-2,4-dione?
3-methyl-1,3-benzothiazine-2,4-dione has a molecular weight of 193.23 g/mol, XLogP of 0.96, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,3-benzothiazine-2,4-dione is sourced from PubChem (CID 11458209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).