C8H8ClF3N2O — CID 114582148
6-chloro-3-(4,4,4-trifluorobutyl)pyrimidin-4-one (PubChem CID 114582148) has the molecular formula C8H8ClF3N2O and a molecular weight of 240.61 g/mol. Its IUPAC name is 6-chloro-3-(4,4,4-trifluorobutyl)pyrimidin-4-one.
| Compound Name | 6-chloro-3-(4,4,4-trifluorobutyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 114582148 |
| Molecular Formula | C8H8ClF3N2O |
| Molecular Weight | 240.61 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 6-chloro-3-(4,4,4-trifluorobutyl)pyrimidin-4-one |
| SMILES | O=c1cc(Cl)ncn1CCCC(F)(F)F |
| InChI | InChI=1S/C8H8ClF3N2O/c9-6-4-7(15)14(5-13-6)3-1-2-8(10,11)12/h4-5H,1-3H2 |
| InChIKey | UVYGEWDQKIQCHH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.61 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |