C8H10ClN3O2 — CID 114582331
2-(4-chloro-6-oxopyrimidin-1-yl)butanamide (PubChem CID 114582331) has the molecular formula C8H10ClN3O2 and a molecular weight of 215.64 g/mol. Its IUPAC name is 2-(4-chloro-6-oxopyrimidin-1-yl)butanamide.
| Compound Name | 2-(4-chloro-6-oxopyrimidin-1-yl)butanamide |
|---|---|
| PubChem CID | 114582331 |
| Molecular Formula | C8H10ClN3O2 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 2-(4-chloro-6-oxopyrimidin-1-yl)butanamide |
| SMILES | CCC(C(N)=O)n1cnc(Cl)cc1=O |
| InChI | InChI=1S/C8H10ClN3O2/c1-2-5(8(10)14)12-4-11-6(9)3-7(12)13/h3-5H,2H2,1H3,(H2,10,14) |
| InChIKey | FNQMESWLCYTJPQ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |