C8H10ClN3O3S — CID 114582466
5-amino-6-chloro-3-(1,1-dioxothiolan-3-yl)pyrimidin-4-one (PubChem CID 114582466) has the molecular formula C8H10ClN3O3S and a molecular weight of 263.71 g/mol. Its IUPAC name is 5-amino-6-chloro-3-(1,1-dioxothiolan-3-yl)pyrimidin-4-one.
| Compound Name | 5-amino-6-chloro-3-(1,1-dioxothiolan-3-yl)pyrimidin-4-one |
|---|---|
| PubChem CID | 114582466 |
| Molecular Formula | C8H10ClN3O3S |
| Molecular Weight | 263.71 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 5-amino-6-chloro-3-(1,1-dioxothiolan-3-yl)pyrimidin-4-one |
| SMILES | Nc1c(Cl)ncn(C2CCS(=O)(=O)C2)c1=O |
| InChI | InChI=1S/C8H10ClN3O3S/c9-7-6(10)8(13)12(4-11-7)5-1-2-16(14,15)3-5/h4-5H,1-3,10H2 |
| InChIKey | OCJKQHROJWXYIP-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.71 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |