C9H13ClN4O3 — CID 114582478
2-(5-amino-4-chloro-6-oxopyrimidin-1-yl)-N-(2-methoxyethyl)acetamide (PubChem CID 114582478) has the molecular formula C9H13ClN4O3 and a molecular weight of 260.68 g/mol. Its IUPAC name is 2-(5-amino-4-chloro-6-oxopyrimidin-1-yl)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(5-amino-4-chloro-6-oxopyrimidin-1-yl)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 114582478 |
| Molecular Formula | C9H13ClN4O3 |
| Molecular Weight | 260.68 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 2-(5-amino-4-chloro-6-oxopyrimidin-1-yl)-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)Cn1cnc(Cl)c(N)c1=O |
| InChI | InChI=1S/C9H13ClN4O3/c1-17-3-2-12-6(15)4-14-5-13-8(10)7(11)9(14)16/h5H,2-4,11H2,1H3,(H,12,15) |
| InChIKey | SHXWKQUXASKHJR-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.68 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|