C12H19ClN4O2 — CID 114582496
2-(5-amino-4-chloro-6-oxopyrimidin-1-yl)-N-(3-methylbutyl)propanamide (PubChem CID 114582496) has the molecular formula C12H19ClN4O2 and a molecular weight of 286.76 g/mol. Its IUPAC name is 2-(5-amino-4-chloro-6-oxopyrimidin-1-yl)-N-(3-methylbutyl)propanamide.
| Compound Name | 2-(5-amino-4-chloro-6-oxopyrimidin-1-yl)-N-(3-methylbutyl)propanamide |
|---|---|
| PubChem CID | 114582496 |
| Molecular Formula | C12H19ClN4O2 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2-(5-amino-4-chloro-6-oxopyrimidin-1-yl)-N-(3-methylbutyl)propanamide |
| SMILES | CC(C)CCNC(=O)C(C)n1cnc(Cl)c(N)c1=O |
| InChI | InChI=1S/C12H19ClN4O2/c1-7(2)4-5-15-11(18)8(3)17-6-16-10(13)9(14)12(17)19/h6-8H,4-5,14H2,1-3H3,(H,15,18) |
| InChIKey | FJPDXLSIGZECMG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |