C10H16ClN3O — CID 114582606
5-amino-6-chloro-3-(3,3-dimethylbutyl)pyrimidin-4-one (PubChem CID 114582606) has the molecular formula C10H16ClN3O and a molecular weight of 229.71 g/mol. Its IUPAC name is 5-amino-6-chloro-3-(3,3-dimethylbutyl)pyrimidin-4-one.
| Compound Name | 5-amino-6-chloro-3-(3,3-dimethylbutyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 114582606 |
| Molecular Formula | C10H16ClN3O |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 5-amino-6-chloro-3-(3,3-dimethylbutyl)pyrimidin-4-one |
| SMILES | CC(C)(C)CCn1cnc(Cl)c(N)c1=O |
| InChI | InChI=1S/C10H16ClN3O/c1-10(2,3)4-5-14-6-13-8(11)7(12)9(14)15/h6H,4-5,12H2,1-3H3 |
| InChIKey | JFSMQTYQIBZDJB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |