C10H13ClN4O2 — CID 114582780
3-(5-amino-4-chloro-6-oxopyrimidin-1-yl)azepan-2-one (PubChem CID 114582780) has the molecular formula C10H13ClN4O2 and a molecular weight of 256.69 g/mol. Its IUPAC name is 3-(5-amino-4-chloro-6-oxopyrimidin-1-yl)azepan-2-one.
| Compound Name | 3-(5-amino-4-chloro-6-oxopyrimidin-1-yl)azepan-2-one |
|---|---|
| PubChem CID | 114582780 |
| Molecular Formula | C10H13ClN4O2 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 3-(5-amino-4-chloro-6-oxopyrimidin-1-yl)azepan-2-one |
| SMILES | Nc1c(Cl)ncn(C2CCCCNC2=O)c1=O |
| InChI | InChI=1S/C10H13ClN4O2/c11-8-7(12)10(17)15(5-14-8)6-3-1-2-4-13-9(6)16/h5-6H,1-4,12H2,(H,13,16) |
| InChIKey | ZVNLDCAYKXAPBL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |