C13H11ClN4O — CID 114582875
4-[(5-amino-4-chloro-6-oxopyrimidin-1-yl)methyl]-3-methylbenzonitrile (PubChem CID 114582875) has the molecular formula C13H11ClN4O and a molecular weight of 274.71 g/mol. Its IUPAC name is 4-[(5-amino-4-chloro-6-oxopyrimidin-1-yl)methyl]-3-methylbenzonitrile.
| Compound Name | 4-[(5-amino-4-chloro-6-oxopyrimidin-1-yl)methyl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 114582875 |
| Molecular Formula | C13H11ClN4O |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 4-[(5-amino-4-chloro-6-oxopyrimidin-1-yl)methyl]-3-methylbenzonitrile |
| SMILES | Cc1cc(C#N)ccc1Cn1cnc(Cl)c(N)c1=O |
| InChI | InChI=1S/C13H11ClN4O/c1-8-4-9(5-15)2-3-10(8)6-18-7-17-12(14)11(16)13(18)19/h2-4,7H,6,16H2,1H3 |
| InChIKey | VFZNEPZSICWOSQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |