C13H17Cl2N3O2 — CID 114582914
N-cycloheptyl-2-(4,5-dichloro-6-oxopyrimidin-1-yl)acetamide (PubChem CID 114582914) has the molecular formula C13H17Cl2N3O2 and a molecular weight of 318.20 g/mol. Its IUPAC name is N-cycloheptyl-2-(4,5-dichloro-6-oxopyrimidin-1-yl)acetamide.
| Compound Name | N-cycloheptyl-2-(4,5-dichloro-6-oxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 114582914 |
| Molecular Formula | C13H17Cl2N3O2 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | N-cycloheptyl-2-(4,5-dichloro-6-oxopyrimidin-1-yl)acetamide |
| SMILES | O=C(Cn1cnc(Cl)c(Cl)c1=O)NC1CCCCCC1 |
| InChI | InChI=1S/C13H17Cl2N3O2/c14-11-12(15)16-8-18(13(11)20)7-10(19)17-9-5-3-1-2-4-6-9/h8-9H,1-7H2,(H,17,19) |
| InChIKey | XUCVIJJFSLPPPV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |