C6H3Cl2F3N2O — CID 114582924
5,6-dichloro-3-(2,2,2-trifluoroethyl)pyrimidin-4-one (PubChem CID 114582924) has the molecular formula C6H3Cl2F3N2O and a molecular weight of 247.00 g/mol. Its IUPAC name is 5,6-dichloro-3-(2,2,2-trifluoroethyl)pyrimidin-4-one.
| Compound Name | 5,6-dichloro-3-(2,2,2-trifluoroethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 114582924 |
| Molecular Formula | C6H3Cl2F3N2O |
| Molecular Weight | 247.00 g/mol |
| Exact Mass | 245.96 |
| IUPAC Name | 5,6-dichloro-3-(2,2,2-trifluoroethyl)pyrimidin-4-one |
| SMILES | O=c1c(Cl)c(Cl)ncn1CC(F)(F)F |
| InChI | InChI=1S/C6H3Cl2F3N2O/c7-3-4(8)12-2-13(5(3)14)1-6(9,10)11/h2H,1H2 |
| InChIKey | WUPXWYBBWASKOQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.00 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |