C12H16Cl2N2O — CID 114582942
5,6-dichloro-3-(4-ethylcyclohexyl)pyrimidin-4-one (PubChem CID 114582942) has the molecular formula C12H16Cl2N2O and a molecular weight of 275.18 g/mol. Its IUPAC name is 5,6-dichloro-3-(4-ethylcyclohexyl)pyrimidin-4-one.
| Compound Name | 5,6-dichloro-3-(4-ethylcyclohexyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 114582942 |
| Molecular Formula | C12H16Cl2N2O |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 5,6-dichloro-3-(4-ethylcyclohexyl)pyrimidin-4-one |
| SMILES | CCC1CCC(n2cnc(Cl)c(Cl)c2=O)CC1 |
| InChI | InChI=1S/C12H16Cl2N2O/c1-2-8-3-5-9(6-4-8)16-7-15-11(14)10(13)12(16)17/h7-9H,2-6H2,1H3 |
| InChIKey | AEHUKVLLSMXRRO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |