C11H13Cl2N3O2 — CID 114582953
5,6-dichloro-3-(2-oxo-2-piperidin-1-ylethyl)pyrimidin-4-one (PubChem CID 114582953) has the molecular formula C11H13Cl2N3O2 and a molecular weight of 290.15 g/mol. Its IUPAC name is 5,6-dichloro-3-(2-oxo-2-piperidin-1-ylethyl)pyrimidin-4-one.
| Compound Name | 5,6-dichloro-3-(2-oxo-2-piperidin-1-ylethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 114582953 |
| Molecular Formula | C11H13Cl2N3O2 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 5,6-dichloro-3-(2-oxo-2-piperidin-1-ylethyl)pyrimidin-4-one |
| SMILES | O=C(Cn1cnc(Cl)c(Cl)c1=O)N1CCCCC1 |
| InChI | InChI=1S/C11H13Cl2N3O2/c12-9-10(13)14-7-16(11(9)18)6-8(17)15-4-2-1-3-5-15/h7H,1-6H2 |
| InChIKey | OAMVCFHYONUHII-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |