C10H14Cl2N2O — CID 114583035
5,6-dichloro-3-(3,3-dimethylbutyl)pyrimidin-4-one (PubChem CID 114583035) has the molecular formula C10H14Cl2N2O and a molecular weight of 249.14 g/mol. Its IUPAC name is 5,6-dichloro-3-(3,3-dimethylbutyl)pyrimidin-4-one.
| Compound Name | 5,6-dichloro-3-(3,3-dimethylbutyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 114583035 |
| Molecular Formula | C10H14Cl2N2O |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 5,6-dichloro-3-(3,3-dimethylbutyl)pyrimidin-4-one |
| SMILES | CC(C)(C)CCn1cnc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C10H14Cl2N2O/c1-10(2,3)4-5-14-6-13-8(12)7(11)9(14)15/h6H,4-5H2,1-3H3 |
| InChIKey | JFVYGHQYFQGTSP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |