C8H10Cl2N2O — CID 114583110
3-butyl-5,6-dichloropyrimidin-4-one (PubChem CID 114583110) has the molecular formula C8H10Cl2N2O and a molecular weight of 221.09 g/mol. Its IUPAC name is 3-butyl-5,6-dichloropyrimidin-4-one.
| Compound Name | 3-butyl-5,6-dichloropyrimidin-4-one |
|---|---|
| PubChem CID | 114583110 |
| Molecular Formula | C8H10Cl2N2O |
| Molecular Weight | 221.09 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 3-butyl-5,6-dichloropyrimidin-4-one |
| SMILES | CCCCn1cnc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C8H10Cl2N2O/c1-2-3-4-12-5-11-7(10)6(9)8(12)13/h5H,2-4H2,1H3 |
| InChIKey | JAOCBNWLGUIUNW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.09 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |