C9H11Cl2N3O2 — CID 114583147
4-(4,5-dichloro-6-oxopyrimidin-1-yl)-N-methylbutanamide (PubChem CID 114583147) has the molecular formula C9H11Cl2N3O2 and a molecular weight of 264.11 g/mol. Its IUPAC name is 4-(4,5-dichloro-6-oxopyrimidin-1-yl)-N-methylbutanamide.
| Compound Name | 4-(4,5-dichloro-6-oxopyrimidin-1-yl)-N-methylbutanamide |
|---|---|
| PubChem CID | 114583147 |
| Molecular Formula | C9H11Cl2N3O2 |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 4-(4,5-dichloro-6-oxopyrimidin-1-yl)-N-methylbutanamide |
| SMILES | CNC(=O)CCCn1cnc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C9H11Cl2N3O2/c1-12-6(15)3-2-4-14-5-13-8(11)7(10)9(14)16/h5H,2-4H2,1H3,(H,12,15) |
| InChIKey | AJYQMXNQAKTQAL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |