C8H7BrClF3N2O2 — CID 114583703
5-bromo-6-chloro-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one (PubChem CID 114583703) has the molecular formula C8H7BrClF3N2O2 and a molecular weight of 335.51 g/mol. Its IUPAC name is 5-bromo-6-chloro-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one.
| Compound Name | 5-bromo-6-chloro-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 114583703 |
| Molecular Formula | C8H7BrClF3N2O2 |
| Molecular Weight | 335.51 g/mol |
| Exact Mass | 333.93 |
| IUPAC Name | 5-bromo-6-chloro-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one |
| SMILES | O=c1c(Br)c(Cl)ncn1CCOCC(F)(F)F |
| InChI | InChI=1S/C8H7BrClF3N2O2/c9-5-6(10)14-4-15(7(5)16)1-2-17-3-8(11,12)13/h4H,1-3H2 |
| InChIKey | FGQLMXCAMDIPOX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|