C11H14ClIN2O2 — CID 114583744
6-chloro-3-[(5,5-dimethyloxolan-2-yl)methyl]-5-iodopyrimidin-4-one (PubChem CID 114583744) has the molecular formula C11H14ClIN2O2 and a molecular weight of 368.60 g/mol. Its IUPAC name is 6-chloro-3-[(5,5-dimethyloxolan-2-yl)methyl]-5-iodopyrimidin-4-one.
| Compound Name | 6-chloro-3-[(5,5-dimethyloxolan-2-yl)methyl]-5-iodopyrimidin-4-one |
|---|---|
| PubChem CID | 114583744 |
| Molecular Formula | C11H14ClIN2O2 |
| Molecular Weight | 368.60 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | 6-chloro-3-[(5,5-dimethyloxolan-2-yl)methyl]-5-iodopyrimidin-4-one |
| SMILES | CC1(C)CCC(Cn2cnc(Cl)c(I)c2=O)O1 |
| InChI | InChI=1S/C11H14ClIN2O2/c1-11(2)4-3-7(17-11)5-15-6-14-9(12)8(13)10(15)16/h6-7H,3-5H2,1-2H3 |
| InChIKey | GWQPETOPUVQGGO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.60 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|