About 6-chloro-3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one
6-chloro-3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one (PubChem CID 114583872) has the molecular formula C7H8ClIN2O3
and a molecular weight of 330.51 g/mol. Its IUPAC name is 6-chloro-3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one.
Molecular Properties
| Compound Name | 6-chloro-3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one |
| PubChem CID | 114583872 |
| Molecular Formula | C7H8ClIN2O3 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 329.93 |
| IUPAC Name | 6-chloro-3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one |
| SMILES | O=c1c(I)c(Cl)ncn1CC(O)CO |
| InChI | InChI=1S/C7H8ClIN2O3/c8-6-5(9)7(14)11(3-10-6)1-4(13)2-12/h3-4,12-13H,1-2H2 |
| InChIKey | QEPAXTZQQDRVNY-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one?
The IUPAC name of 6-chloro-3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one (CID 114583872) is 6-chloro-3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one.
What is the SMILES notation for 6-chloro-3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one?
The canonical SMILES for 6-chloro-3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one is O=c1c(I)c(Cl)ncn1CC(O)CO.
What is the InChIKey of 6-chloro-3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one?
The InChIKey is QEPAXTZQQDRVNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClIN2O3/c8-6-5(9)7(14)11(3-10-6)1-4(13)2-12/h3-4,12-13H,1-2H2.
What are the key properties of 6-chloro-3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one?
6-chloro-3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one has a molecular weight of 330.51 g/mol, XLogP of -0.15, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one is sourced from PubChem (CID 114583872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).