About diethyl 2-sulfanylbutanedioate
diethyl 2-sulfanylbutanedioate (PubChem CID 11458400) has the molecular formula C8H14O4S
and a molecular weight of 206.26 g/mol. Its IUPAC name is diethyl 2-sulfanylbutanedioate.
Molecular Properties
| Compound Name | diethyl 2-sulfanylbutanedioate |
| PubChem CID | 11458400 |
| Molecular Formula | C8H14O4S |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | diethyl 2-sulfanylbutanedioate |
| SMILES | CCOC(=O)CC(S)C(=O)OCC |
| InChI | InChI=1S/C8H14O4S/c1-3-11-7(9)5-6(13)8(10)12-4-2/h6,13H,3-5H2,1-2H3 |
| InChIKey | KLXFSKITMRWDPM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-sulfanylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-sulfanylbutanedioate?
The IUPAC name of diethyl 2-sulfanylbutanedioate (CID 11458400) is diethyl 2-sulfanylbutanedioate.
What is the SMILES notation for diethyl 2-sulfanylbutanedioate?
The canonical SMILES for diethyl 2-sulfanylbutanedioate is CCOC(=O)CC(S)C(=O)OCC.
What is the InChIKey of diethyl 2-sulfanylbutanedioate?
The InChIKey is KLXFSKITMRWDPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4S/c1-3-11-7(9)5-6(13)8(10)12-4-2/h6,13H,3-5H2,1-2H3.
What are the key properties of diethyl 2-sulfanylbutanedioate?
diethyl 2-sulfanylbutanedioate has a molecular weight of 206.26 g/mol, XLogP of 0.80, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-sulfanylbutanedioate is sourced from PubChem (CID 11458400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).