C9H9ClIN5O — CID 114584012
6-chloro-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-5-iodopyrimidin-4-one (PubChem CID 114584012) has the molecular formula C9H9ClIN5O and a molecular weight of 365.56 g/mol. Its IUPAC name is 6-chloro-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-5-iodopyrimidin-4-one.
| Compound Name | 6-chloro-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-5-iodopyrimidin-4-one |
|---|---|
| PubChem CID | 114584012 |
| Molecular Formula | C9H9ClIN5O |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 364.95 |
| IUPAC Name | 6-chloro-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-5-iodopyrimidin-4-one |
| SMILES | Cc1nnc(Cn2cnc(Cl)c(I)c2=O)n1C |
| InChI | InChI=1S/C9H9ClIN5O/c1-5-13-14-6(15(5)2)3-16-4-12-8(10)7(11)9(16)17/h4H,3H2,1-2H3 |
| InChIKey | BYMLDLBDFUDUTL-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|