C12H8ClFIN3O2 — CID 114584066
2-(4-chloro-5-iodo-6-oxopyrimidin-1-yl)-N-(3-fluorophenyl)acetamide (PubChem CID 114584066) has the molecular formula C12H8ClFIN3O2 and a molecular weight of 407.57 g/mol. Its IUPAC name is 2-(4-chloro-5-iodo-6-oxopyrimidin-1-yl)-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-(4-chloro-5-iodo-6-oxopyrimidin-1-yl)-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 114584066 |
| Molecular Formula | C12H8ClFIN3O2 |
| Molecular Weight | 407.57 g/mol |
| Exact Mass | 406.93 |
| IUPAC Name | 2-(4-chloro-5-iodo-6-oxopyrimidin-1-yl)-N-(3-fluorophenyl)acetamide |
| SMILES | O=C(Cn1cnc(Cl)c(I)c1=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C12H8ClFIN3O2/c13-11-10(15)12(20)18(6-16-11)5-9(19)17-8-3-1-2-7(14)4-8/h1-4,6H,5H2,(H,17,19) |
| InChIKey | LEPMGYGELAUNND-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.57 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|