C8H8ClF3N2O — CID 114584199
6-chloro-2-ethyl-3-(2,2,2-trifluoroethyl)pyrimidin-4-one (PubChem CID 114584199) has the molecular formula C8H8ClF3N2O and a molecular weight of 240.61 g/mol. Its IUPAC name is 6-chloro-2-ethyl-3-(2,2,2-trifluoroethyl)pyrimidin-4-one.
| Compound Name | 6-chloro-2-ethyl-3-(2,2,2-trifluoroethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 114584199 |
| Molecular Formula | C8H8ClF3N2O |
| Molecular Weight | 240.61 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 6-chloro-2-ethyl-3-(2,2,2-trifluoroethyl)pyrimidin-4-one |
| SMILES | CCc1nc(Cl)cc(=O)n1CC(F)(F)F |
| InChI | InChI=1S/C8H8ClF3N2O/c1-2-6-13-5(9)3-7(15)14(6)4-8(10,11)12/h3H,2,4H2,1H3 |
| InChIKey | QJTVNYKPYMERDV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.61 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |