C10H12ClF3N2O — CID 114584264
6-chloro-2-ethyl-3-(4,4,4-trifluorobutyl)pyrimidin-4-one (PubChem CID 114584264) has the molecular formula C10H12ClF3N2O and a molecular weight of 268.67 g/mol. Its IUPAC name is 6-chloro-2-ethyl-3-(4,4,4-trifluorobutyl)pyrimidin-4-one.
| Compound Name | 6-chloro-2-ethyl-3-(4,4,4-trifluorobutyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 114584264 |
| Molecular Formula | C10H12ClF3N2O |
| Molecular Weight | 268.67 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 6-chloro-2-ethyl-3-(4,4,4-trifluorobutyl)pyrimidin-4-one |
| SMILES | CCc1nc(Cl)cc(=O)n1CCCC(F)(F)F |
| InChI | InChI=1S/C10H12ClF3N2O/c1-2-8-15-7(11)6-9(17)16(8)5-3-4-10(12,13)14/h6H,2-5H2,1H3 |
| InChIKey | FLJYDAPGGGIODZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.67 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |