C12H18ClN3O3 — CID 114584421
2-(4-chloro-2-ethyl-6-oxopyrimidin-1-yl)-N-(1-methoxypropan-2-yl)acetamide (PubChem CID 114584421) has the molecular formula C12H18ClN3O3 and a molecular weight of 287.75 g/mol. Its IUPAC name is 2-(4-chloro-2-ethyl-6-oxopyrimidin-1-yl)-N-(1-methoxypropan-2-yl)acetamide.
| Compound Name | 2-(4-chloro-2-ethyl-6-oxopyrimidin-1-yl)-N-(1-methoxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 114584421 |
| Molecular Formula | C12H18ClN3O3 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-(4-chloro-2-ethyl-6-oxopyrimidin-1-yl)-N-(1-methoxypropan-2-yl)acetamide |
| SMILES | CCc1nc(Cl)cc(=O)n1CC(=O)NC(C)COC |
| InChI | InChI=1S/C12H18ClN3O3/c1-4-10-15-9(13)5-12(18)16(10)6-11(17)14-8(2)7-19-3/h5,8H,4,6-7H2,1-3H3,(H,14,17) |
| InChIKey | LONKWLUZLNMJCI-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |