C11H13ClN4O2 — CID 114585107
6-chloro-3-[(1-ethylimidazol-2-yl)methyl]-5-methoxypyrimidin-4-one (PubChem CID 114585107) has the molecular formula C11H13ClN4O2 and a molecular weight of 268.70 g/mol. Its IUPAC name is 6-chloro-3-[(1-ethylimidazol-2-yl)methyl]-5-methoxypyrimidin-4-one.
| Compound Name | 6-chloro-3-[(1-ethylimidazol-2-yl)methyl]-5-methoxypyrimidin-4-one |
|---|---|
| PubChem CID | 114585107 |
| Molecular Formula | C11H13ClN4O2 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 6-chloro-3-[(1-ethylimidazol-2-yl)methyl]-5-methoxypyrimidin-4-one |
| SMILES | CCn1ccnc1Cn1cnc(Cl)c(OC)c1=O |
| InChI | InChI=1S/C11H13ClN4O2/c1-3-15-5-4-13-8(15)6-16-7-14-10(12)9(18-2)11(16)17/h4-5,7H,3,6H2,1-2H3 |
| InChIKey | AKIKZVUHQBZYBD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |