About ethyl (E)-2-acetyloct-4-enoate
ethyl (E)-2-acetyloct-4-enoate (PubChem CID 11458522) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is ethyl (E)-2-acetyloct-4-enoate.
Molecular Properties
| Compound Name | ethyl (E)-2-acetyloct-4-enoate |
| PubChem CID | 11458522 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | ethyl (E)-2-acetyloct-4-enoate |
| SMILES | CCC/C=C/CC(C(C)=O)C(=O)OCC |
| InChI | InChI=1S/C12H20O3/c1-4-6-7-8-9-11(10(3)13)12(14)15-5-2/h7-8,11H,4-6,9H2,1-3H3/b8-7+ |
| InChIKey | GHXJIXKBFOPYMS-BQYQJAHWSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-2-acetyloct-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-2-acetyloct-4-enoate?
The IUPAC name of ethyl (E)-2-acetyloct-4-enoate (CID 11458522) is ethyl (E)-2-acetyloct-4-enoate.
What is the SMILES notation for ethyl (E)-2-acetyloct-4-enoate?
The canonical SMILES for ethyl (E)-2-acetyloct-4-enoate is CCC/C=C/CC(C(C)=O)C(=O)OCC.
What is the InChIKey of ethyl (E)-2-acetyloct-4-enoate?
The InChIKey is GHXJIXKBFOPYMS-BQYQJAHWSA-N. The full InChI is InChI=1S/C12H20O3/c1-4-6-7-8-9-11(10(3)13)12(14)15-5-2/h7-8,11H,4-6,9H2,1-3H3/b8-7+.
What are the key properties of ethyl (E)-2-acetyloct-4-enoate?
ethyl (E)-2-acetyloct-4-enoate has a molecular weight of 212.29 g/mol, XLogP of 2.50, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-2-acetyloct-4-enoate is sourced from PubChem (CID 11458522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).