C9H10ClF3N2O3 — CID 114585481
6-chloro-5-methoxy-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one (PubChem CID 114585481) has the molecular formula C9H10ClF3N2O3 and a molecular weight of 286.64 g/mol. Its IUPAC name is 6-chloro-5-methoxy-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one.
| Compound Name | 6-chloro-5-methoxy-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 114585481 |
| Molecular Formula | C9H10ClF3N2O3 |
| Molecular Weight | 286.64 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 6-chloro-5-methoxy-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one |
| SMILES | COc1c(Cl)ncn(CCOCC(F)(F)F)c1=O |
| InChI | InChI=1S/C9H10ClF3N2O3/c1-17-6-7(10)14-5-15(8(6)16)2-3-18-4-9(11,12)13/h5H,2-4H2,1H3 |
| InChIKey | UKVHPWTYDOQXOY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.64 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|