C12H22O3 — CID 11458559
(E)-5-[(4R,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]pent-2-en-1-ol (PubChem CID 11458559) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is (E)-5-[(4R,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]pent-2-en-1-ol.
| Compound Name | (E)-5-[(4R,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]pent-2-en-1-ol |
|---|---|
| PubChem CID | 11458559 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (E)-5-[(4R,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]pent-2-en-1-ol |
| SMILES | C[C@H]1COC(C)(C)O[C@@H]1CC/C=C/CO |
| InChI | InChI=1S/C12H22O3/c1-10-9-14-12(2,3)15-11(10)7-5-4-6-8-13/h4,6,10-11,13H,5,7-9H2,1-3H3/b6-4+/t10-,11+/m0/s1 |
| InChIKey | QEKDQLRLGAUXEI-XDFYEUQUSA-N |
| XLogP | 2.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|