C13H12N2O5 — CID 114585672
2-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)oxy]-4-methylbenzoic acid (PubChem CID 114585672) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is 2-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)oxy]-4-methylbenzoic acid.
| Compound Name | 2-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)oxy]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 114585672 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)oxy]-4-methylbenzoic acid |
| SMILES | COc1c(Oc2cc(C)ccc2C(=O)O)nc[nH]c1=O |
| InChI | InChI=1S/C13H12N2O5/c1-7-3-4-8(13(17)18)9(5-7)20-12-10(19-2)11(16)14-6-15-12/h3-6H,1-2H3,(H,17,18)(H,14,15,16) |
| InChIKey | OXNVJHQVCWJXNC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |