C14H20N2 — CID 11458601
2,4-diethyl-2-methyl-1,3-dihydro-1,5-benzodiazepine (PubChem CID 11458601) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2,4-diethyl-2-methyl-1,3-dihydro-1,5-benzodiazepine.
| Compound Name | 2,4-diethyl-2-methyl-1,3-dihydro-1,5-benzodiazepine |
|---|---|
| PubChem CID | 11458601 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2,4-diethyl-2-methyl-1,3-dihydro-1,5-benzodiazepine |
| SMILES | CCC1=Nc2ccccc2NC(C)(CC)C1 |
| InChI | InChI=1S/C14H20N2/c1-4-11-10-14(3,5-2)16-13-9-7-6-8-12(13)15-11/h6-9,16H,4-5,10H2,1-3H3 |
| InChIKey | XQVLTNVSPORWQO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |