C11H19N3O2 — CID 114586310
4-[1-(methylamino)propan-2-yloxy]-2-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 114586310) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is 4-[1-(methylamino)propan-2-yloxy]-2-propan-2-yl-1H-pyrimidin-6-one.
| Compound Name | 4-[1-(methylamino)propan-2-yloxy]-2-propan-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114586310 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 4-[1-(methylamino)propan-2-yloxy]-2-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | CNCC(C)Oc1cc(=O)[nH]c(C(C)C)n1 |
| InChI | InChI=1S/C11H19N3O2/c1-7(2)11-13-9(15)5-10(14-11)16-8(3)6-12-4/h5,7-8,12H,6H2,1-4H3,(H,13,14,15) |
| InChIKey | ANHRSXUOUFARPH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |