C13H21N3O3 — CID 114586499
4-[(1-aminocycloheptyl)methoxy]-5-methoxy-1H-pyrimidin-6-one (PubChem CID 114586499) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-[(1-aminocycloheptyl)methoxy]-5-methoxy-1H-pyrimidin-6-one.
| Compound Name | 4-[(1-aminocycloheptyl)methoxy]-5-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114586499 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 4-[(1-aminocycloheptyl)methoxy]-5-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1c(OCC2(N)CCCCCC2)nc[nH]c1=O |
| InChI | InChI=1S/C13H21N3O3/c1-18-10-11(17)15-9-16-12(10)19-8-13(14)6-4-2-3-5-7-13/h9H,2-8,14H2,1H3,(H,15,16,17) |
| InChIKey | LLFQBPONPQTXSJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |