C9H14N4O3 — CID 114586612
5-amino-4-(morpholin-2-ylmethoxy)-1H-pyrimidin-6-one (PubChem CID 114586612) has the molecular formula C9H14N4O3 and a molecular weight of 226.24 g/mol. Its IUPAC name is 5-amino-4-(morpholin-2-ylmethoxy)-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-(morpholin-2-ylmethoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114586612 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 5-amino-4-(morpholin-2-ylmethoxy)-1H-pyrimidin-6-one |
| SMILES | Nc1c(OCC2CNCCO2)nc[nH]c1=O |
| InChI | InChI=1S/C9H14N4O3/c10-7-8(14)12-5-13-9(7)16-4-6-3-11-1-2-15-6/h5-6,11H,1-4,10H2,(H,12,13,14) |
| InChIKey | ZYTULDTWLKMOEY-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |