C23H26N2O7 — CID 1145872
4-[(3S)-3,5-bis(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid (PubChem CID 1145872) has the molecular formula C23H26N2O7 and a molecular weight of 442.47 g/mol. Its IUPAC name is 4-[(3S)-3,5-bis(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid.
| Compound Name | 4-[(3S)-3,5-bis(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 1145872 |
| Molecular Formula | C23H26N2O7 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 4-[(3S)-3,5-bis(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid |
| SMILES | COc1ccc(C2=NN(C(=O)CCC(=O)O)[C@H](c3ccc(OC)c(OC)c3)C2)cc1OC |
| InChI | InChI=1S/C23H26N2O7/c1-29-18-7-5-14(11-20(18)31-3)16-13-17(25(24-16)22(26)9-10-23(27)28)15-6-8-19(30-2)21(12-15)32-4/h5-8,11-12,17H,9-10,13H2,1-4H3,(H,27,28)/t17-/m0/s1 |
| InChIKey | NVLOHLZMMQHMRI-KRWDZBQOSA-N |
| XLogP | 3.26 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |