C8H5F5O2 — CID 11458817
(Z)-1,1,1,2,2-pentafluoro-7-methoxyhept-6-en-4-yn-3-one (PubChem CID 11458817) has the molecular formula C8H5F5O2 and a molecular weight of 228.12 g/mol. Its IUPAC name is (Z)-1,1,1,2,2-pentafluoro-7-methoxyhept-6-en-4-yn-3-one.
| Compound Name | (Z)-1,1,1,2,2-pentafluoro-7-methoxyhept-6-en-4-yn-3-one |
|---|---|
| PubChem CID | 11458817 |
| Molecular Formula | C8H5F5O2 |
| Molecular Weight | 228.12 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | (Z)-1,1,1,2,2-pentafluoro-7-methoxyhept-6-en-4-yn-3-one |
| SMILES | CO/C=C\C#CC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H5F5O2/c1-15-5-3-2-4-6(14)7(9,10)8(11,12)13/h3,5H,1H3/b5-3- |
| InChIKey | UVNMDNRHMUQQEB-HYXAFXHYSA-N |
| XLogP | 1.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.12 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|