C14H17NO2 — CID 11458897
[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl] benzoate (PubChem CID 11458897) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is [(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl] benzoate.
| Compound Name | [(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl] benzoate |
|---|---|
| PubChem CID | 11458897 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | [(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl] benzoate |
| SMILES | O=C(OC1C[C@H]2CC[C@@H](C1)N2)c1ccccc1 |
| InChI | InChI=1S/C14H17NO2/c16-14(10-4-2-1-3-5-10)17-13-8-11-6-7-12(9-13)15-11/h1-5,11-13,15H,6-9H2/t11-,12+,13? |
| InChIKey | AZHSHGVBEAPALY-FUNVUKJBSA-N |
| XLogP | 2.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |