C14H16O3 — CID 11458920
(4aR,8aS)-3,8a-dimethyl-4a,5,7,8-tetrahydro-4H-benzo[f][1]benzofuran-6,9-dione (PubChem CID 11458920) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is (4aR,8aS)-3,8a-dimethyl-4a,5,7,8-tetrahydro-4H-benzo[f][1]benzofuran-6,9-dione.
| Compound Name | (4aR,8aS)-3,8a-dimethyl-4a,5,7,8-tetrahydro-4H-benzo[f][1]benzofuran-6,9-dione |
|---|---|
| PubChem CID | 11458920 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | (4aR,8aS)-3,8a-dimethyl-4a,5,7,8-tetrahydro-4H-benzo[f][1]benzofuran-6,9-dione |
| SMILES | Cc1coc2c1C[C@@H]1CC(=O)CC[C@]1(C)C2=O |
| InChI | InChI=1S/C14H16O3/c1-8-7-17-12-11(8)6-9-5-10(15)3-4-14(9,2)13(12)16/h7,9H,3-6H2,1-2H3/t9-,14-/m0/s1 |
| InChIKey | PIKODMSTURGEQB-XPTSAGLGSA-N |
| XLogP | 2.70 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |