C15H22O2 — CID 11458977
(1S,6S,10R,12S,17R)-11,13-dioxatetracyclo[8.7.0.01,6.012,17]heptadec-7-ene (PubChem CID 11458977) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (1S,6S,10R,12S,17R)-11,13-dioxatetracyclo[8.7.0.01,6.012,17]heptadec-7-ene.
| Compound Name | (1S,6S,10R,12S,17R)-11,13-dioxatetracyclo[8.7.0.01,6.012,17]heptadec-7-ene |
|---|---|
| PubChem CID | 11458977 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (1S,6S,10R,12S,17R)-11,13-dioxatetracyclo[8.7.0.01,6.012,17]heptadec-7-ene |
| SMILES | C1=C[C@@H]2CCCC[C@]23[C@@H](C1)O[C@@H]1OCCC[C@@H]13 |
| InChI | InChI=1S/C15H22O2/c1-2-9-15-11(5-1)6-3-8-13(15)17-14-12(15)7-4-10-16-14/h3,6,11-14H,1-2,4-5,7-10H2/t11-,12-,13+,14-,15-/m0/s1 |
| InChIKey | CYODRNSZURHJPL-RMEBNNNOSA-N |
| XLogP | 3.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|