About 4,8-dichloro-2-(2,3-dihydro-1H-inden-5-yl)quinazoline
4,8-dichloro-2-(2,3-dihydro-1H-inden-5-yl)quinazoline (PubChem CID 114589771) has the molecular formula C17H12Cl2N2
and a molecular weight of 315.20 g/mol. Its IUPAC name is 4,8-dichloro-2-(2,3-dihydro-1H-inden-5-yl)quinazoline.
Molecular Properties
| Compound Name | 4,8-dichloro-2-(2,3-dihydro-1H-inden-5-yl)quinazoline |
| PubChem CID | 114589771 |
| Molecular Formula | C17H12Cl2N2 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 4,8-dichloro-2-(2,3-dihydro-1H-inden-5-yl)quinazoline |
| SMILES | Clc1nc(-c2ccc3c(c2)CCC3)nc2c(Cl)cccc12 |
| InChI | InChI=1S/C17H12Cl2N2/c18-14-6-2-5-13-15(14)20-17(21-16(13)19)12-8-7-10-3-1-4-11(10)9-12/h2,5-9H,1,3-4H2 |
| InChIKey | SNDDFOYNABQZCC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,8-dichloro-2-(2,3-dihydro-1H-inden-5-yl)quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-dichloro-2-(2,3-dihydro-1H-inden-5-yl)quinazoline?
The IUPAC name of 4,8-dichloro-2-(2,3-dihydro-1H-inden-5-yl)quinazoline (CID 114589771) is 4,8-dichloro-2-(2,3-dihydro-1H-inden-5-yl)quinazoline.
What is the SMILES notation for 4,8-dichloro-2-(2,3-dihydro-1H-inden-5-yl)quinazoline?
The canonical SMILES for 4,8-dichloro-2-(2,3-dihydro-1H-inden-5-yl)quinazoline is Clc1nc(-c2ccc3c(c2)CCC3)nc2c(Cl)cccc12.
What is the InChIKey of 4,8-dichloro-2-(2,3-dihydro-1H-inden-5-yl)quinazoline?
The InChIKey is SNDDFOYNABQZCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12Cl2N2/c18-14-6-2-5-13-15(14)20-17(21-16(13)19)12-8-7-10-3-1-4-11(10)9-12/h2,5-9H,1,3-4H2.
What are the key properties of 4,8-dichloro-2-(2,3-dihydro-1H-inden-5-yl)quinazoline?
4,8-dichloro-2-(2,3-dihydro-1H-inden-5-yl)quinazoline has a molecular weight of 315.20 g/mol, XLogP of 5.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-dichloro-2-(2,3-dihydro-1H-inden-5-yl)quinazoline is sourced from PubChem (CID 114589771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).