C15H26Si — CID 11458981
[(3E,5E)-dodeca-3,5-dien-1-ynyl]-trimethylsilane (PubChem CID 11458981) has the molecular formula C15H26Si and a molecular weight of 234.46 g/mol. Its IUPAC name is [(3E,5E)-dodeca-3,5-dien-1-ynyl]-trimethylsilane.
| Compound Name | [(3E,5E)-dodeca-3,5-dien-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 11458981 |
| Molecular Formula | C15H26Si |
| Molecular Weight | 234.46 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | [(3E,5E)-dodeca-3,5-dien-1-ynyl]-trimethylsilane |
| SMILES | CCCCCC/C=C/C=C/C#C[Si](C)(C)C |
| InChI | InChI=1S/C15H26Si/c1-5-6-7-8-9-10-11-12-13-14-15-16(2,3)4/h10-13H,5-9H2,1-4H3/b11-10+,13-12+ |
| InChIKey | JOYAFJIPYDMPKB-AQASXUMVSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|