About 4-chloro-2-(2-ethylphenyl)-6,8-dimethylquinazoline
4-chloro-2-(2-ethylphenyl)-6,8-dimethylquinazoline (PubChem CID 114590401) has the molecular formula C18H17ClN2
and a molecular weight of 296.80 g/mol. Its IUPAC name is 4-chloro-2-(2-ethylphenyl)-6,8-dimethylquinazoline.
Molecular Properties
| Compound Name | 4-chloro-2-(2-ethylphenyl)-6,8-dimethylquinazoline |
| PubChem CID | 114590401 |
| Molecular Formula | C18H17ClN2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 4-chloro-2-(2-ethylphenyl)-6,8-dimethylquinazoline |
| SMILES | CCc1ccccc1-c1nc(Cl)c2cc(C)cc(C)c2n1 |
| InChI | InChI=1S/C18H17ClN2/c1-4-13-7-5-6-8-14(13)18-20-16-12(3)9-11(2)10-15(16)17(19)21-18/h5-10H,4H2,1-3H3 |
| InChIKey | AJNBKUBHWIDPQG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-2-(2-ethylphenyl)-6,8-dimethylquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(2-ethylphenyl)-6,8-dimethylquinazoline?
The IUPAC name of 4-chloro-2-(2-ethylphenyl)-6,8-dimethylquinazoline (CID 114590401) is 4-chloro-2-(2-ethylphenyl)-6,8-dimethylquinazoline.
What is the SMILES notation for 4-chloro-2-(2-ethylphenyl)-6,8-dimethylquinazoline?
The canonical SMILES for 4-chloro-2-(2-ethylphenyl)-6,8-dimethylquinazoline is CCc1ccccc1-c1nc(Cl)c2cc(C)cc(C)c2n1.
What is the InChIKey of 4-chloro-2-(2-ethylphenyl)-6,8-dimethylquinazoline?
The InChIKey is AJNBKUBHWIDPQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClN2/c1-4-13-7-5-6-8-14(13)18-20-16-12(3)9-11(2)10-15(16)17(19)21-18/h5-10H,4H2,1-3H3.
What are the key properties of 4-chloro-2-(2-ethylphenyl)-6,8-dimethylquinazoline?
4-chloro-2-(2-ethylphenyl)-6,8-dimethylquinazoline has a molecular weight of 296.80 g/mol, XLogP of 5.13, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(2-ethylphenyl)-6,8-dimethylquinazoline is sourced from PubChem (CID 114590401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).