C15H26O2 — CID 11459065
(3R,3aS,8aS)-3-[(2S)-1-hydroxypropan-2-yl]-5,8a-dimethyl-2,3,3a,6,7,8-hexahydro-1H-azulen-6-ol (PubChem CID 11459065) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (3R,3aS,8aS)-3-[(2S)-1-hydroxypropan-2-yl]-5,8a-dimethyl-2,3,3a,6,7,8-hexahydro-1H-azulen-6-ol.
| Compound Name | (3R,3aS,8aS)-3-[(2S)-1-hydroxypropan-2-yl]-5,8a-dimethyl-2,3,3a,6,7,8-hexahydro-1H-azulen-6-ol |
|---|---|
| PubChem CID | 11459065 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (3R,3aS,8aS)-3-[(2S)-1-hydroxypropan-2-yl]-5,8a-dimethyl-2,3,3a,6,7,8-hexahydro-1H-azulen-6-ol |
| SMILES | CC1=C[C@@H]2[C@H]([C@H](C)CO)CC[C@@]2(C)CCC1O |
| InChI | InChI=1S/C15H26O2/c1-10-8-13-12(11(2)9-16)4-6-15(13,3)7-5-14(10)17/h8,11-14,16-17H,4-7,9H2,1-3H3/t11-,12+,13-,14?,15+/m1/s1 |
| InChIKey | CEWJIZSNJTVULF-LJIAPDMLSA-N |
| XLogP | 2.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|