C17H26N2O — CID 114591852
3-(3-aminophenyl)-1-(2,3,5-trimethylpiperidin-1-yl)propan-1-one (PubChem CID 114591852) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 3-(3-aminophenyl)-1-(2,3,5-trimethylpiperidin-1-yl)propan-1-one.
| Compound Name | 3-(3-aminophenyl)-1-(2,3,5-trimethylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 114591852 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 3-(3-aminophenyl)-1-(2,3,5-trimethylpiperidin-1-yl)propan-1-one |
| SMILES | CC1CC(C)C(C)N(C(=O)CCc2cccc(N)c2)C1 |
| InChI | InChI=1S/C17H26N2O/c1-12-9-13(2)14(3)19(11-12)17(20)8-7-15-5-4-6-16(18)10-15/h4-6,10,12-14H,7-9,11,18H2,1-3H3 |
| InChIKey | OQFLXKUYLIVVFI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|