C16H22N2 — CID 114593236
4-methyl-2-(2,3,5-trimethylpiperidin-1-yl)benzonitrile (PubChem CID 114593236) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 4-methyl-2-(2,3,5-trimethylpiperidin-1-yl)benzonitrile.
| Compound Name | 4-methyl-2-(2,3,5-trimethylpiperidin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 114593236 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 4-methyl-2-(2,3,5-trimethylpiperidin-1-yl)benzonitrile |
| SMILES | Cc1ccc(C#N)c(N2CC(C)CC(C)C2C)c1 |
| InChI | InChI=1S/C16H22N2/c1-11-5-6-15(9-17)16(8-11)18-10-12(2)7-13(3)14(18)4/h5-6,8,12-14H,7,10H2,1-4H3 |
| InChIKey | XACDCTZSQFCOMB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |