C16H26O2 — CID 11459375
[(1S,4S,7R)-4,8,8-trimethyl-2-methylidene-4-bicyclo[5.2.0]nonanyl]methyl acetate (PubChem CID 11459375) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is [(1S,4S,7R)-4,8,8-trimethyl-2-methylidene-4-bicyclo[5.2.0]nonanyl]methyl acetate.
| Compound Name | [(1S,4S,7R)-4,8,8-trimethyl-2-methylidene-4-bicyclo[5.2.0]nonanyl]methyl acetate |
|---|---|
| PubChem CID | 11459375 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | [(1S,4S,7R)-4,8,8-trimethyl-2-methylidene-4-bicyclo[5.2.0]nonanyl]methyl acetate |
| SMILES | C=C1C[C@@](C)(COC(C)=O)CC[C@@H]2[C@@H]1CC2(C)C |
| InChI | InChI=1S/C16H26O2/c1-11-8-16(5,10-18-12(2)17)7-6-14-13(11)9-15(14,3)4/h13-14H,1,6-10H2,2-5H3/t13-,14-,16+/m1/s1 |
| InChIKey | DQIYNENWJHGCCR-FMKPAKJESA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|