About 1-[4-(chloromethyl)-2-(trifluoromethyl)phenyl]-2,3,5-trimethylpiperidine
1-[4-(chloromethyl)-2-(trifluoromethyl)phenyl]-2,3,5-trimethylpiperidine (PubChem CID 114594078) has the molecular formula C16H21ClF3N
and a molecular weight of 319.80 g/mol. Its IUPAC name is 1-[4-(chloromethyl)-2-(trifluoromethyl)phenyl]-2,3,5-trimethylpiperidine.
Molecular Properties
| Compound Name | 1-[4-(chloromethyl)-2-(trifluoromethyl)phenyl]-2,3,5-trimethylpiperidine |
| PubChem CID | 114594078 |
| Molecular Formula | C16H21ClF3N |
| Molecular Weight | 319.80 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 1-[4-(chloromethyl)-2-(trifluoromethyl)phenyl]-2,3,5-trimethylpiperidine |
| SMILES | CC1CC(C)C(C)N(c2ccc(CCl)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C16H21ClF3N/c1-10-6-11(2)12(3)21(9-10)15-5-4-13(8-17)7-14(15)16(18,19)20/h4-5,7,10-12H,6,8-9H2,1-3H3 |
| InChIKey | IGSQWWHURMLNQJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.80 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(chloromethyl)-2-(trifluoromethyl)phenyl]-2,3,5-trimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(chloromethyl)-2-(trifluoromethyl)phenyl]-2,3,5-trimethylpiperidine?
The IUPAC name of 1-[4-(chloromethyl)-2-(trifluoromethyl)phenyl]-2,3,5-trimethylpiperidine (CID 114594078) is 1-[4-(chloromethyl)-2-(trifluoromethyl)phenyl]-2,3,5-trimethylpiperidine.
What is the SMILES notation for 1-[4-(chloromethyl)-2-(trifluoromethyl)phenyl]-2,3,5-trimethylpiperidine?
The canonical SMILES for 1-[4-(chloromethyl)-2-(trifluoromethyl)phenyl]-2,3,5-trimethylpiperidine is CC1CC(C)C(C)N(c2ccc(CCl)cc2C(F)(F)F)C1.
What is the InChIKey of 1-[4-(chloromethyl)-2-(trifluoromethyl)phenyl]-2,3,5-trimethylpiperidine?
The InChIKey is IGSQWWHURMLNQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21ClF3N/c1-10-6-11(2)12(3)21(9-10)15-5-4-13(8-17)7-14(15)16(18,19)20/h4-5,7,10-12H,6,8-9H2,1-3H3.
What are the key properties of 1-[4-(chloromethyl)-2-(trifluoromethyl)phenyl]-2,3,5-trimethylpiperidine?
1-[4-(chloromethyl)-2-(trifluoromethyl)phenyl]-2,3,5-trimethylpiperidine has a molecular weight of 319.80 g/mol, XLogP of 5.32, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(chloromethyl)-2-(trifluoromethyl)phenyl]-2,3,5-trimethylpiperidine is sourced from PubChem (CID 114594078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).