C13H20O3Si — CID 11459420
(3R,6aS)-3-prop-2-enoxy-4-trimethylsilyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one (PubChem CID 11459420) has the molecular formula C13H20O3Si and a molecular weight of 252.39 g/mol. Its IUPAC name is (3R,6aS)-3-prop-2-enoxy-4-trimethylsilyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one.
| Compound Name | (3R,6aS)-3-prop-2-enoxy-4-trimethylsilyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one |
|---|---|
| PubChem CID | 11459420 |
| Molecular Formula | C13H20O3Si |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | (3R,6aS)-3-prop-2-enoxy-4-trimethylsilyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one |
| SMILES | C=CCO[C@@H]1OC[C@H]2CC(=O)C([Si](C)(C)C)=C21 |
| InChI | InChI=1S/C13H20O3Si/c1-5-6-15-13-11-9(8-16-13)7-10(14)12(11)17(2,3)4/h5,9,13H,1,6-8H2,2-4H3/t9-,13-/m1/s1 |
| InChIKey | NECPBUCRFOKWSL-NOZJJQNGSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|