About 3-(4-methylphenyl)-1,4-benzodithiine
3-(4-methylphenyl)-1,4-benzodithiine (PubChem CID 11459536) has the molecular formula C15H12S2
and a molecular weight of 256.40 g/mol. Its IUPAC name is 3-(4-methylphenyl)-1,4-benzodithiine.
Molecular Properties
| Compound Name | 3-(4-methylphenyl)-1,4-benzodithiine |
| PubChem CID | 11459536 |
| Molecular Formula | C15H12S2 |
| Molecular Weight | 256.40 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 3-(4-methylphenyl)-1,4-benzodithiine |
| SMILES | Cc1ccc(C2=CSc3ccccc3S2)cc1 |
| InChI | InChI=1S/C15H12S2/c1-11-6-8-12(9-7-11)15-10-16-13-4-2-3-5-14(13)17-15/h2-10H,1H3 |
| InChIKey | JXUGXJWMAYSAPV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.40 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-methylphenyl)-1,4-benzodithiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methylphenyl)-1,4-benzodithiine?
The IUPAC name of 3-(4-methylphenyl)-1,4-benzodithiine (CID 11459536) is 3-(4-methylphenyl)-1,4-benzodithiine.
What is the SMILES notation for 3-(4-methylphenyl)-1,4-benzodithiine?
The canonical SMILES for 3-(4-methylphenyl)-1,4-benzodithiine is Cc1ccc(C2=CSc3ccccc3S2)cc1.
What is the InChIKey of 3-(4-methylphenyl)-1,4-benzodithiine?
The InChIKey is JXUGXJWMAYSAPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12S2/c1-11-6-8-12(9-7-11)15-10-16-13-4-2-3-5-14(13)17-15/h2-10H,1H3.
What are the key properties of 3-(4-methylphenyl)-1,4-benzodithiine?
3-(4-methylphenyl)-1,4-benzodithiine has a molecular weight of 256.40 g/mol, XLogP of 5.19, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylphenyl)-1,4-benzodithiine is sourced from PubChem (CID 11459536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).